ibotenic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

2-amino-2-(3-oxo-1,2-oxazol-5-yl)acetic acid; ibotenic acid
Links:🕷 ChemSpider
MeSH:Excitatory Amino Acid Agonists; Neurotransmitter Agents
CAS RN:[2552-55-8]
Formula:C5H6N2O4; 158.11 g/mol
InChiKey:IRJCBFDCFXCWGO-UHFFFAOYSA-N
SMILES:NC(C(O)=O)C1=CC(=O)NO1
Molecular structure of ibotenic acid

Isomers

N-carbamoylmaleamic acid
Molecular structure of N-carbamoylmaleamic acid
L-dihydroorotic acid
Molecular structure of L-dihydroorotic acid
hydantoin-5-acetic acid
Molecular structure of hydantoin-5-acetic acid
D-hydroorotic acid
Molecular structure of D-hydroorotic acid
ibotenic acid
Molecular structure of ibotenic acid
methyl 4-methylfurazancarboxylate 2-oxide
Molecular structure of methyl 4-methylfurazancarboxylate 2-oxide
  ::